C20H39O4P-2 — CID 25245113
[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] phosphate (PubChem CID 25245113) has the molecular formula C20H39O4P-2 and a molecular weight of 374.50 g/mol. Its IUPAC name is [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] phosphate.
| Compound Name | [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] phosphate |
|---|---|
| PubChem CID | 25245113 |
| Molecular Formula | C20H39O4P-2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] phosphate |
| SMILES | C/C(=C\COP(=O)([O-])[O-])CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H41O4P/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-24-25(21,22)23/h15,17-19H,6-14,16H2,1-5H3,(H2,21,22,23)/p-2/b20-15+/t18-,19-/m1/s1 |
| InChIKey | YRXRHZOKDFCXIB-PYDDKJGSSA-L |
| XLogP | 5.22 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|