C11H11NO2S — CID 25246418
(4R)-2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 25246418) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is (4R)-2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4R)-2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 25246418 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (4R)-2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(Cc2ccccc2)=N1 |
| InChI | InChI=1S/C11H11NO2S/c13-11(14)9-7-15-10(12-9)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14)/t9-/m0/s1 |
| InChIKey | AMKMKGAHKRINRV-VIFPVBQESA-N |
| XLogP | 1.83 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |