About 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one
2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one (PubChem CID 25246653) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one |
| PubChem CID | 25246653 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one |
| SMILES | CCCN1C(=O)C(C)=C(C)C1OC |
| InChI | InChI=1S/C10H17NO2/c1-5-6-11-9(12)7(2)8(3)10(11)13-4/h10H,5-6H2,1-4H3 |
| InChIKey | CPRBRLYKPTVFDM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one?
The IUPAC name of 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one (CID 25246653) is 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one.
What is the SMILES notation for 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one?
The canonical SMILES for 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one is CCCN1C(=O)C(C)=C(C)C1OC.
What is the InChIKey of 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one?
The InChIKey is CPRBRLYKPTVFDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-5-6-11-9(12)7(2)8(3)10(11)13-4/h10H,5-6H2,1-4H3.
What are the key properties of 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one?
2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one has a molecular weight of 183.25 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,4-dimethyl-1-propyl-2H-pyrrol-5-one is sourced from PubChem (CID 25246653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).