C13H15N3O2S — CID 25246908
N-(2-hydroxyethyl)-2-(3-methylanilino)-1,3-thiazole-4-carboxamide (PubChem CID 25246908) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-(3-methylanilino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-2-(3-methylanilino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 25246908 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(2-hydroxyethyl)-2-(3-methylanilino)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cccc(Nc2nc(C(=O)NCCO)cs2)c1 |
| InChI | InChI=1S/C13H15N3O2S/c1-9-3-2-4-10(7-9)15-13-16-11(8-19-13)12(18)14-5-6-17/h2-4,7-8,17H,5-6H2,1H3,(H,14,18)(H,15,16) |
| InChIKey | XTCIRSNYPIPMPT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |