C13H17ClN2O3S — CID 25247054
4-chloro-N,N-dimethyl-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 25247054) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N,N-dimethyl-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 25247054 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-chloro-N,N-dimethyl-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C13H17ClN2O3S/c1-15(2)13(17)10-5-6-11(14)12(9-10)20(18,19)16-7-3-4-8-16/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | XRVXKGIHWRRTPH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |