C18H20ClN3O4 — CID 25247132
2-chloro-N-(4,5-dimethoxy-2-morpholin-4-ylphenyl)pyridine-3-carboxamide (PubChem CID 25247132) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is 2-chloro-N-(4,5-dimethoxy-2-morpholin-4-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(4,5-dimethoxy-2-morpholin-4-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25247132 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-chloro-N-(4,5-dimethoxy-2-morpholin-4-ylphenyl)pyridine-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccnc2Cl)c(N2CCOCC2)cc1OC |
| InChI | InChI=1S/C18H20ClN3O4/c1-24-15-10-13(21-18(23)12-4-3-5-20-17(12)19)14(11-16(15)25-2)22-6-8-26-9-7-22/h3-5,10-11H,6-9H2,1-2H3,(H,21,23) |
| InChIKey | QPLSINMBHVIFSK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|