About 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid
3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid (PubChem CID 25247186) has the molecular formula C8H11IN2O2
and a molecular weight of 294.09 g/mol. Its IUPAC name is 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid |
| PubChem CID | 25247186 |
| Molecular Formula | C8H11IN2O2 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid |
| SMILES | Cc1nn(CCC(=O)O)c(C)c1I |
| InChI | InChI=1S/C8H11IN2O2/c1-5-8(9)6(2)11(10-5)4-3-7(12)13/h3-4H2,1-2H3,(H,12,13) |
| InChIKey | CKKYOUULJSNVAQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid?
The IUPAC name of 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid (CID 25247186) is 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid.
What is the SMILES notation for 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid?
The canonical SMILES for 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid is Cc1nn(CCC(=O)O)c(C)c1I.
What is the InChIKey of 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid?
The InChIKey is CKKYOUULJSNVAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11IN2O2/c1-5-8(9)6(2)11(10-5)4-3-7(12)13/h3-4H2,1-2H3,(H,12,13).
What are the key properties of 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid?
3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid has a molecular weight of 294.09 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-iodo-3,5-dimethylpyrazol-1-yl)propanoic acid is sourced from PubChem (CID 25247186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).