About 1-(2,2-difluoroethyl)pyrazole
1-(2,2-difluoroethyl)pyrazole (PubChem CID 25247479) has the molecular formula C5H6F2N2
and a molecular weight of 132.11 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyrazole.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)pyrazole |
| PubChem CID | 25247479 |
| Molecular Formula | C5H6F2N2 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyrazole |
| SMILES | FC(F)Cn1cccn1 |
| InChI | InChI=1S/C5H6F2N2/c6-5(7)4-9-3-1-2-8-9/h1-3,5H,4H2 |
| InChIKey | PAPXVYOWIDXXAS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-difluoroethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)pyrazole?
The IUPAC name of 1-(2,2-difluoroethyl)pyrazole (CID 25247479) is 1-(2,2-difluoroethyl)pyrazole.
What is the SMILES notation for 1-(2,2-difluoroethyl)pyrazole?
The canonical SMILES for 1-(2,2-difluoroethyl)pyrazole is FC(F)Cn1cccn1.
What is the InChIKey of 1-(2,2-difluoroethyl)pyrazole?
The InChIKey is PAPXVYOWIDXXAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2N2/c6-5(7)4-9-3-1-2-8-9/h1-3,5H,4H2.
What are the key properties of 1-(2,2-difluoroethyl)pyrazole?
1-(2,2-difluoroethyl)pyrazole has a molecular weight of 132.11 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)pyrazole is sourced from PubChem (CID 25247479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).