C20H19N3O6 — CID 2524808
2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 2524808) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2524808 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CN2C(=O)C(=O)N(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C20H19N3O6/c1-28-14-8-9-16(29-2)15(10-14)21-17(24)12-23-19(26)18(25)22(20(23)27)11-13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3,(H,21,24) |
| InChIKey | GOHRNMVWKBKKRN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|