About 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol
2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol (PubChem CID 25248177) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol.
Molecular Properties
| Compound Name | 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol |
| PubChem CID | 25248177 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol |
| SMILES | OCCc1cnc2ncnn2c1 |
| InChI | InChI=1S/C7H8N4O/c12-2-1-6-3-8-7-9-5-10-11(7)4-6/h3-5,12H,1-2H2 |
| InChIKey | QQRXAPDUQYJTJO-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol?
The IUPAC name of 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol (CID 25248177) is 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol.
What is the SMILES notation for 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol?
The canonical SMILES for 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol is OCCc1cnc2ncnn2c1.
What is the InChIKey of 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol?
The InChIKey is QQRXAPDUQYJTJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c12-2-1-6-3-8-7-9-5-10-11(7)4-6/h3-5,12H,1-2H2.
What are the key properties of 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol?
2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol has a molecular weight of 164.17 g/mol, XLogP of -0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanol is sourced from PubChem (CID 25248177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).