About 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid
3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid (PubChem CID 25248459) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid.
Analyze 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid?
The IUPAC name of 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid (CID 25248459) is 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid.
What is the SMILES notation for 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid?
The canonical SMILES for 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid is Cc1cc(C2CCCN2CCC(=O)O)nn1C.
What is the InChIKey of 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid?
The InChIKey is UIJYNJSGLVSOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-9-8-10(13-14(9)2)11-4-3-6-15(11)7-5-12(16)17/h8,11H,3-7H2,1-2H3,(H,16,17).
What are the key properties of 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid?
3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid has a molecular weight of 237.30 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,5-dimethylpyrazol-3-yl)pyrrolidin-1-yl]propanoic acid is sourced from PubChem (CID 25248459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).