About 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid
3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid (PubChem CID 25248730) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid |
| PubChem CID | 25248730 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid |
| SMILES | Nc1n[nH]c(CCC(=O)O)n1 |
| InChI | InChI=1S/C5H8N4O2/c6-5-7-3(8-9-5)1-2-4(10)11/h1-2H2,(H,10,11)(H3,6,7,8,9) |
| InChIKey | AKCLMRLUECNBLP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid?
The IUPAC name of 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid (CID 25248730) is 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid.
What is the SMILES notation for 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid?
The canonical SMILES for 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid is Nc1n[nH]c(CCC(=O)O)n1.
What is the InChIKey of 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid?
The InChIKey is AKCLMRLUECNBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c6-5-7-3(8-9-5)1-2-4(10)11/h1-2H2,(H,10,11)(H3,6,7,8,9).
What are the key properties of 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid?
3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid has a molecular weight of 156.15 g/mol, XLogP of -0.60, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1H-1,2,4-triazol-5-yl)propanoic acid is sourced from PubChem (CID 25248730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).