About 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole
1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole (PubChem CID 25248861) has the molecular formula C14H17N3O5S
and a molecular weight of 339.37 g/mol. Its IUPAC name is 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole.
Molecular Properties
| Compound Name | 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole |
| PubChem CID | 25248861 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole |
| SMILES | CCOc1c(S(=O)(=O)n2c([N+](=O)[O-])cnc2C)ccc(C)c1C |
| InChI | InChI=1S/C14H17N3O5S/c1-5-22-14-10(3)9(2)6-7-12(14)23(20,21)16-11(4)15-8-13(16)17(18)19/h6-8H,5H2,1-4H3 |
| InChIKey | ODRIDMIARKBWIM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole?
The IUPAC name of 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole (CID 25248861) is 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole.
What is the SMILES notation for 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole?
The canonical SMILES for 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole is CCOc1c(S(=O)(=O)n2c([N+](=O)[O-])cnc2C)ccc(C)c1C.
What is the InChIKey of 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole?
The InChIKey is ODRIDMIARKBWIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O5S/c1-5-22-14-10(3)9(2)6-7-12(14)23(20,21)16-11(4)15-8-13(16)17(18)19/h6-8H,5H2,1-4H3.
What are the key properties of 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole?
1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole has a molecular weight of 339.37 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethoxy-3,4-dimethylphenyl)sulfonyl-2-methyl-5-nitroimidazole is sourced from PubChem (CID 25248861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).