C23H20N4O3S — CID 25249066
10-amino-12-methylsulfanyl-8-(3-phenylmethoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-6-one (PubChem CID 25249066) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 10-amino-12-methylsulfanyl-8-(3-phenylmethoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-6-one.
| Compound Name | 10-amino-12-methylsulfanyl-8-(3-phenylmethoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-6-one |
|---|---|
| PubChem CID | 25249066 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 10-amino-12-methylsulfanyl-8-(3-phenylmethoxyphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-6-one |
| SMILES | CSc1nc(N)c2c(n1)NC1=C(C(=O)OC1)C2c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H20N4O3S/c1-31-23-26-20(24)19-17(18-16(12-30-22(18)28)25-21(19)27-23)14-8-5-9-15(10-14)29-11-13-6-3-2-4-7-13/h2-10,17H,11-12H2,1H3,(H3,24,25,26,27) |
| InChIKey | IZKVXIFJJIYXRX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |