C20H12N2O2S2 — CID 25249097
4,11-diphenyl-3λ4,10λ4-dithia-1,6-diazatricyclo[7.3.0.02,6]dodeca-2,3,7,9,10-pentaene-5,12-dione (PubChem CID 25249097) has the molecular formula C20H12N2O2S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4,11-diphenyl-3λ4,10λ4-dithia-1,6-diazatricyclo[7.3.0.02,6]dodeca-2,3,7,9,10-pentaene-5,12-dione.
| Compound Name | 4,11-diphenyl-3λ4,10λ4-dithia-1,6-diazatricyclo[7.3.0.02,6]dodeca-2,3,7,9,10-pentaene-5,12-dione |
|---|---|
| PubChem CID | 25249097 |
| Molecular Formula | C20H12N2O2S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4,11-diphenyl-3λ4,10λ4-dithia-1,6-diazatricyclo[7.3.0.02,6]dodeca-2,3,7,9,10-pentaene-5,12-dione |
| SMILES | O=C1C(c2ccccc2)=S=C2N1C=CC1=S=C(c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C20H12N2O2S2/c23-18-16(13-7-3-1-4-8-13)26-20-21(18)12-11-15-22(20)19(24)17(25-15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | IJQGTCCIIIUYCG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|