C21H17F4N3O2 — CID 25249770
2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]-N-(2,3,5,6-tetrafluorophenyl)propanamide (PubChem CID 25249770) has the molecular formula C21H17F4N3O2 and a molecular weight of 419.38 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]-N-(2,3,5,6-tetrafluorophenyl)propanamide.
| Compound Name | 2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]-N-(2,3,5,6-tetrafluorophenyl)propanamide |
|---|---|
| PubChem CID | 25249770 |
| Molecular Formula | C21H17F4N3O2 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]-N-(2,3,5,6-tetrafluorophenyl)propanamide |
| SMILES | Cc1ccc(C)c(-c2ccc(=O)n(C(C)C(=O)Nc3c(F)c(F)cc(F)c3F)n2)c1 |
| InChI | InChI=1S/C21H17F4N3O2/c1-10-4-5-11(2)13(8-10)16-6-7-17(29)28(27-16)12(3)21(30)26-20-18(24)14(22)9-15(23)19(20)25/h4-9,12H,1-3H3,(H,26,30) |
| InChIKey | JAIWNSXHLOLRTC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|