C15H7ClF3N5O — CID 25251779
11-[4-chloro-3-(trifluoromethyl)phenyl]-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 25251779) has the molecular formula C15H7ClF3N5O and a molecular weight of 365.70 g/mol. Its IUPAC name is 11-[4-chloro-3-(trifluoromethyl)phenyl]-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-[4-chloro-3-(trifluoromethyl)phenyl]-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 25251779 |
| Molecular Formula | C15H7ClF3N5O |
| Molecular Weight | 365.70 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 11-[4-chloro-3-(trifluoromethyl)phenyl]-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | O=c1c2cnc3ncnn3c2ccn1-c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H7ClF3N5O/c16-11-2-1-8(5-10(11)15(17,18)19)23-4-3-12-9(13(23)25)6-20-14-21-7-22-24(12)14/h1-7H |
| InChIKey | KZZFWXLUXDUDGB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |