C25H22N4O4 — CID 25252305
11-(2,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 25252305) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 11-(2,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(2,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 25252305 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 11-(2,4-dimethoxyphenyl)-5-(4-methoxyphenyl)-4-methyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COc1ccc(-c2c(C)nn3c2ncc2c(=O)n(-c4ccc(OC)cc4OC)ccc23)cc1 |
| InChI | InChI=1S/C25H22N4O4/c1-15-23(16-5-7-17(31-2)8-6-16)24-26-14-19-20(29(24)27-15)11-12-28(25(19)30)21-10-9-18(32-3)13-22(21)33-4/h5-14H,1-4H3 |
| InChIKey | QVRIEXFHUSMTAH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |