About [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine
[4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine (PubChem CID 25252612) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine |
| PubChem CID | 25252612 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine |
| SMILES | NCc1ccc(-c2nc3cnccc3o2)cc1 |
| InChI | InChI=1S/C13H11N3O/c14-7-9-1-3-10(4-2-9)13-16-11-8-15-6-5-12(11)17-13/h1-6,8H,7,14H2 |
| InChIKey | ARWZPSFKWSWVPZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine?
The IUPAC name of [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine (CID 25252612) is [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine.
What is the SMILES notation for [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine?
The canonical SMILES for [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine is NCc1ccc(-c2nc3cnccc3o2)cc1.
What is the InChIKey of [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine?
The InChIKey is ARWZPSFKWSWVPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c14-7-9-1-3-10(4-2-9)13-16-11-8-15-6-5-12(11)17-13/h1-6,8H,7,14H2.
What are the key properties of [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine?
[4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine has a molecular weight of 225.25 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]methanamine is sourced from PubChem (CID 25252612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).