C17H10N2O2S — CID 25252996
5-thiophen-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 25252996) has the molecular formula C17H10N2O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 5-thiophen-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-thiophen-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 25252996 |
| Molecular Formula | C17H10N2O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-thiophen-3-ylbenzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccsc1)c1ccncc12 |
| InChI | InChI=1S/C17H10N2O2S/c20-17(21)10-1-2-12-14-8-18-5-3-13(14)16(19-15(12)7-10)11-4-6-22-9-11/h1-9H,(H,20,21) |
| InChIKey | AFSNNEJIKHHNDD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|