C21H22N4O3 — CID 25253091
2-(N-[(E)-3-(1H-indazol-3-yl)prop-2-enoyl]anilino)ethyl N-ethylcarbamate (PubChem CID 25253091) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(N-[(E)-3-(1H-indazol-3-yl)prop-2-enoyl]anilino)ethyl N-ethylcarbamate.
| Compound Name | 2-(N-[(E)-3-(1H-indazol-3-yl)prop-2-enoyl]anilino)ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 25253091 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-(N-[(E)-3-(1H-indazol-3-yl)prop-2-enoyl]anilino)ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCN(C(=O)/C=C/c1n[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O3/c1-2-22-21(27)28-15-14-25(16-8-4-3-5-9-16)20(26)13-12-19-17-10-6-7-11-18(17)23-24-19/h3-13H,2,14-15H2,1H3,(H,22,27)(H,23,24)/b13-12+ |
| InChIKey | CJSBCKMMYPEEPA-OUKQBFOZSA-N |
| XLogP | 3.36 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|