C17H18N2OS — CID 2525315
4-(1H-indol-3-yl)-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 2525315) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 2525315 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NCc1cccs1 |
| InChI | InChI=1S/C17H18N2OS/c20-17(19-12-14-6-4-10-21-14)9-3-5-13-11-18-16-8-2-1-7-15(13)16/h1-2,4,6-8,10-11,18H,3,5,9,12H2,(H,19,20) |
| InChIKey | YGDIBUJFPFPDFC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |