About 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol
3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol (PubChem CID 25253209) has the molecular formula C15H13ClF3NO
and a molecular weight of 315.72 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol |
| PubChem CID | 25253209 |
| Molecular Formula | C15H13ClF3NO |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol |
| SMILES | CC(c1cccc(Cl)c1)C(O)(c1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C15H13ClF3NO/c1-10(11-4-2-6-13(16)8-11)14(21,15(17,18)19)12-5-3-7-20-9-12/h2-10,21H,1H3 |
| InChIKey | IUKAOBMATIELIZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol?
The IUPAC name of 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol (CID 25253209) is 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol.
What is the SMILES notation for 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol?
The canonical SMILES for 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol is CC(c1cccc(Cl)c1)C(O)(c1cccnc1)C(F)(F)F.
What is the InChIKey of 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol?
The InChIKey is IUKAOBMATIELIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClF3NO/c1-10(11-4-2-6-13(16)8-11)14(21,15(17,18)19)12-5-3-7-20-9-12/h2-10,21H,1H3.
What are the key properties of 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol?
3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol has a molecular weight of 315.72 g/mol, XLogP of 4.29, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-1,1,1-trifluoro-2-pyridin-3-ylbutan-2-ol is sourced from PubChem (CID 25253209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).