C16H17F2N3O4 — CID 25253349
4-[6-(2,2-difluoroethoxy)-2,4-dioxoquinazolin-1-yl]piperidine-1-carbaldehyde (PubChem CID 25253349) has the molecular formula C16H17F2N3O4 and a molecular weight of 353.33 g/mol. Its IUPAC name is 4-[6-(2,2-difluoroethoxy)-2,4-dioxoquinazolin-1-yl]piperidine-1-carbaldehyde.
| Compound Name | 4-[6-(2,2-difluoroethoxy)-2,4-dioxoquinazolin-1-yl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 25253349 |
| Molecular Formula | C16H17F2N3O4 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-[6-(2,2-difluoroethoxy)-2,4-dioxoquinazolin-1-yl]piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(n2c(=O)[nH]c(=O)c3cc(OCC(F)F)ccc32)CC1 |
| InChI | InChI=1S/C16H17F2N3O4/c17-14(18)8-25-11-1-2-13-12(7-11)15(23)19-16(24)21(13)10-3-5-20(9-22)6-4-10/h1-2,7,9-10,14H,3-6,8H2,(H,19,23,24) |
| InChIKey | TXEZVKHORRCRLJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|