C22H22FN5O4 — CID 25253663
8-amino-7-fluoro-10-oxo-6-[2-(pyridin-2-ylamino)ethylamino]spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclobutane]-11-carboxylic acid (PubChem CID 25253663) has the molecular formula C22H22FN5O4 and a molecular weight of 439.45 g/mol. Its IUPAC name is 8-amino-7-fluoro-10-oxo-6-[2-(pyridin-2-ylamino)ethylamino]spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclobutane]-11-carboxylic acid.
| Compound Name | 8-amino-7-fluoro-10-oxo-6-[2-(pyridin-2-ylamino)ethylamino]spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclobutane]-11-carboxylic acid |
|---|---|
| PubChem CID | 25253663 |
| Molecular Formula | C22H22FN5O4 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 8-amino-7-fluoro-10-oxo-6-[2-(pyridin-2-ylamino)ethylamino]spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclobutane]-11-carboxylic acid |
| SMILES | Nc1c(F)c(NCCNc2ccccn2)c2c3c1c(=O)c(C(=O)O)cn3C1(CCC1)CO2 |
| InChI | InChI=1S/C22H22FN5O4/c23-15-16(24)14-18-20(17(15)27-9-8-26-13-4-1-2-7-25-13)32-11-22(5-3-6-22)28(18)10-12(19(14)29)21(30)31/h1-2,4,7,10,27H,3,5-6,8-9,11,24H2,(H,25,26)(H,30,31) |
| InChIKey | LICRTEFFCPRCPL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|