C26H30F3N3O2 — CID 25253675
[2-[(2-methoxyphenyl)methylamino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 25253675) has the molecular formula C26H30F3N3O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 25253675 |
| Molecular Formula | C26H30F3N3O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | COc1ccccc1CNC1CC2CCCC2(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C26H30F3N3O2/c1-34-23-7-3-2-5-17(23)14-30-21-12-19-6-4-9-25(19,13-21)24(33)32-10-8-22-18(16-32)11-20(15-31-22)26(27,28)29/h2-3,5,7,11,15,19,21,30H,4,6,8-10,12-14,16H2,1H3 |
| InChIKey | COUAVRODHLIRMG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |