About 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]
8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine] (PubChem CID 25253912) has the molecular formula C20H20FN5O
and a molecular weight of 365.41 g/mol. Its IUPAC name is 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine].
Molecular Properties
| Compound Name | 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine] |
| PubChem CID | 25253912 |
| Molecular Formula | C20H20FN5O |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine] |
| SMILES | Fc1cccc2c1OC1(CC2)CCN(c2ccc(-n3ccnc3)nn2)CC1 |
| InChI | InChI=1S/C20H20FN5O/c21-16-3-1-2-15-6-7-20(27-19(15)16)8-11-25(12-9-20)17-4-5-18(24-23-17)26-13-10-22-14-26/h1-5,10,13-14H,6-9,11-12H2 |
| InChIKey | YOXFMLWLIZDSMV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]?
The IUPAC name of 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine] (CID 25253912) is 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine].
What is the SMILES notation for 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]?
The canonical SMILES for 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine] is Fc1cccc2c1OC1(CC2)CCN(c2ccc(-n3ccnc3)nn2)CC1.
What is the InChIKey of 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]?
The InChIKey is YOXFMLWLIZDSMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN5O/c21-16-3-1-2-15-6-7-20(27-19(15)16)8-11-25(12-9-20)17-4-5-18(24-23-17)26-13-10-22-14-26/h1-5,10,13-14H,6-9,11-12H2.
What are the key properties of 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]?
8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine] has a molecular weight of 365.41 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-1'-(6-imidazol-1-ylpyridazin-3-yl)spiro[3,4-dihydrochromene-2,4'-piperidine] is sourced from PubChem (CID 25253912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).