About 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one
1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one (PubChem CID 25253914) has the molecular formula C18H21N3O2
and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one.
Molecular Properties
| Compound Name | 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one |
| PubChem CID | 25253914 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one |
| SMILES | CNC[C@@H](O)[C@H](c1ccccc1)n1c(=O)n(C)c2ccccc21 |
| InChI | InChI=1S/C18H21N3O2/c1-19-12-16(22)17(13-8-4-3-5-9-13)21-15-11-7-6-10-14(15)20(2)18(21)23/h3-11,16-17,19,22H,12H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | WFCCOUNTGTUDOI-SJORKVTESA-N |
| XLogP | 1.51 |
| TPSA | 59.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one?
The IUPAC name of 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one (CID 25253914) is 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one.
What is the SMILES notation for 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one?
The canonical SMILES for 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one is CNC[C@@H](O)[C@H](c1ccccc1)n1c(=O)n(C)c2ccccc21.
What is the InChIKey of 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one?
The InChIKey is WFCCOUNTGTUDOI-SJORKVTESA-N. The full InChI is InChI=1S/C18H21N3O2/c1-19-12-16(22)17(13-8-4-3-5-9-13)21-15-11-7-6-10-14(15)20(2)18(21)23/h3-11,16-17,19,22H,12H2,1-2H3/t16-,17+/m1/s1.
What are the key properties of 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one?
1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one has a molecular weight of 311.38 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]-3-methylbenzimidazol-2-one is sourced from PubChem (CID 25253914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).