About 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one
1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one (PubChem CID 25253915) has the molecular formula C19H22FN3O2
and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one.
Molecular Properties
| Compound Name | 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one |
| PubChem CID | 25253915 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one |
| SMILES | CCn1c(=O)n([C@@H](c2ccccc2)[C@H](O)CNC)c2cc(F)ccc21 |
| InChI | InChI=1S/C19H22FN3O2/c1-3-22-15-10-9-14(20)11-16(15)23(19(22)25)18(17(24)12-21-2)13-7-5-4-6-8-13/h4-11,17-18,21,24H,3,12H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | DBNIRDAYCJINLF-MSOLQXFVSA-N |
| XLogP | 2.13 |
| TPSA | 59.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one?
The IUPAC name of 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one (CID 25253915) is 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one.
What is the SMILES notation for 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one?
The canonical SMILES for 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one is CCn1c(=O)n([C@@H](c2ccccc2)[C@H](O)CNC)c2cc(F)ccc21.
What is the InChIKey of 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one?
The InChIKey is DBNIRDAYCJINLF-MSOLQXFVSA-N. The full InChI is InChI=1S/C19H22FN3O2/c1-3-22-15-10-9-14(20)11-16(15)23(19(22)25)18(17(24)12-21-2)13-7-5-4-6-8-13/h4-11,17-18,21,24H,3,12H2,1-2H3/t17-,18+/m1/s1.
What are the key properties of 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one?
1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one has a molecular weight of 343.40 g/mol, XLogP of 2.13, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-fluoro-3-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]benzimidazol-2-one is sourced from PubChem (CID 25253915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).