C20H24ClF3N2O4 — CID 25254297
3-[2-chloro-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,1,1-trifluoro-2-(5-methylpyrazin-2-yl)butan-2-ol (PubChem CID 25254297) has the molecular formula C20H24ClF3N2O4 and a molecular weight of 448.87 g/mol. Its IUPAC name is 3-[2-chloro-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,1,1-trifluoro-2-(5-methylpyrazin-2-yl)butan-2-ol.
| Compound Name | 3-[2-chloro-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,1,1-trifluoro-2-(5-methylpyrazin-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 25254297 |
| Molecular Formula | C20H24ClF3N2O4 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 3-[2-chloro-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,1,1-trifluoro-2-(5-methylpyrazin-2-yl)butan-2-ol |
| SMILES | COCCOCCOc1ccc(C(C)C(O)(c2cnc(C)cn2)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H24ClF3N2O4/c1-13-11-26-18(12-25-13)19(27,20(22,23)24)14(2)16-5-4-15(10-17(16)21)30-9-8-29-7-6-28-3/h4-5,10-12,14,27H,6-9H2,1-3H3 |
| InChIKey | JRWXEZWZWJKVAI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|