C17H14Cl2F3NO3 — CID 25254450
2-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]acetic acid (PubChem CID 25254450) has the molecular formula C17H14Cl2F3NO3 and a molecular weight of 408.20 g/mol. Its IUPAC name is 2-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 25254450 |
| Molecular Formula | C17H14Cl2F3NO3 |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]acetic acid |
| SMILES | CC(c1ccc(CC(=O)O)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C17H14Cl2F3NO3/c1-9(12-3-2-10(6-13(12)18)7-15(24)25)16(26,17(20,21)22)11-4-5-23-14(19)8-11/h2-6,8-9,26H,7H2,1H3,(H,24,25) |
| InChIKey | OMHPHLNXQCCGIQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|