C18H16Cl2F3NO3 — CID 25254451
3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]propanoic acid (PubChem CID 25254451) has the molecular formula C18H16Cl2F3NO3 and a molecular weight of 422.23 g/mol. Its IUPAC name is 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 25254451 |
| Molecular Formula | C18H16Cl2F3NO3 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]propanoic acid |
| SMILES | CC(c1ccc(CCC(=O)O)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C18H16Cl2F3NO3/c1-10(13-4-2-11(8-14(13)19)3-5-16(25)26)17(27,18(21,22)23)12-6-7-24-15(20)9-12/h2,4,6-10,27H,3,5H2,1H3,(H,25,26) |
| InChIKey | WNQUHNVXHYDISG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|