About N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine
N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine (PubChem CID 25254484) has the molecular formula C31H27Cl4N5
and a molecular weight of 611.40 g/mol. Its IUPAC name is N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine.
Molecular Properties
| Compound Name | N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine |
| PubChem CID | 25254484 |
| Molecular Formula | C31H27Cl4N5 |
| Molecular Weight | 611.40 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine |
| SMILES | Clc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(Cl)c(Cl)c4)c-3c/c2=N\CCCN2CCCC2)cc1Cl |
| InChI | InChI=1S/C31H27Cl4N5/c32-22-10-8-20(16-24(22)34)37-28-18-29-31(19-27(28)36-12-5-15-39-13-3-4-14-39)40(21-9-11-23(33)25(35)17-21)30-7-2-1-6-26(30)38-29/h1-2,6-11,16-19,37H,3-5,12-15H2/b36-27+ |
| InChIKey | QVOLVMVDRIOADZ-KJFHWCLQSA-N |
| XLogP | 8.87 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 611.40 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine?
The IUPAC name of N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine (CID 25254484) is N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine.
What is the SMILES notation for N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine?
The canonical SMILES for N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine is Clc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(Cl)c(Cl)c4)c-3c/c2=N\CCCN2CCCC2)cc1Cl.
What is the InChIKey of N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine?
The InChIKey is QVOLVMVDRIOADZ-KJFHWCLQSA-N. The full InChI is InChI=1S/C31H27Cl4N5/c32-22-10-8-20(16-24(22)34)37-28-18-29-31(19-27(28)36-12-5-15-39-13-3-4-14-39)40(21-9-11-23(33)25(35)17-21)30-7-2-1-6-26(30)38-29/h1-2,6-11,16-19,37H,3-5,12-15H2/b36-27+.
What are the key properties of N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine?
N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine has a molecular weight of 611.40 g/mol, XLogP of 8.87, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-bis(3,4-dichlorophenyl)-3-(3-pyrrolidin-1-ylpropylimino)phenazin-2-amine is sourced from PubChem (CID 25254484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).