C25H25ClF3N5O — CID 25254680
(2R)-2-[2-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-N-[6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-1-carboxamide (PubChem CID 25254680) has the molecular formula C25H25ClF3N5O and a molecular weight of 503.96 g/mol. Its IUPAC name is (2R)-2-[2-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-N-[6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-[2-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-N-[6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 25254680 |
| Molecular Formula | C25H25ClF3N5O |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (2R)-2-[2-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-N-[6-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NC1CCCc2cc(C(F)(F)F)ccc21)N1CCC[C@@H]1c1ncnn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClF3N5O/c26-19-9-6-16(7-10-19)14-34-23(30-15-31-34)22-5-2-12-33(22)24(35)32-21-4-1-3-17-13-18(25(27,28)29)8-11-20(17)21/h6-11,13,15,21-22H,1-5,12,14H2,(H,32,35)/t21?,22-/m1/s1 |
| InChIKey | QTDSTAQUTWDXIP-FOIFJWKZSA-N |
| XLogP | 5.92 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |