About 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine
4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine (PubChem CID 25255101) has the molecular formula C9H8Cl2N4OS
and a molecular weight of 291.16 g/mol. Its IUPAC name is 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine.
Molecular Properties
| Compound Name | 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine |
| PubChem CID | 25255101 |
| Molecular Formula | C9H8Cl2N4OS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine |
| SMILES | Clc1nc(N2CCOCC2)c2sc(Cl)nc2n1 |
| InChI | InChI=1S/C9H8Cl2N4OS/c10-8-12-6-5(17-9(11)13-6)7(14-8)15-1-3-16-4-2-15/h1-4H2 |
| InChIKey | MBMSIXRYINXXCZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine?
The IUPAC name of 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine (CID 25255101) is 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine.
What is the SMILES notation for 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine?
The canonical SMILES for 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine is Clc1nc(N2CCOCC2)c2sc(Cl)nc2n1.
What is the InChIKey of 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine?
The InChIKey is MBMSIXRYINXXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2N4OS/c10-8-12-6-5(17-9(11)13-6)7(14-8)15-1-3-16-4-2-15/h1-4H2.
What are the key properties of 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine?
4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine has a molecular weight of 291.16 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichloro-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine is sourced from PubChem (CID 25255101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).