C22H21F3N4O4 — CID 25255875
N-cyclohexyl-N-methyl-2-nitro-4-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 25255875) has the molecular formula C22H21F3N4O4 and a molecular weight of 462.43 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-nitro-4-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | N-cyclohexyl-N-methyl-2-nitro-4-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 25255875 |
| Molecular Formula | C22H21F3N4O4 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-nitro-4-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CN(c1ccc(-c2nc(-c3ccccc3OC(F)(F)F)no2)cc1[N+](=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C22H21F3N4O4/c1-28(15-7-3-2-4-8-15)17-12-11-14(13-18(17)29(30)31)21-26-20(27-33-21)16-9-5-6-10-19(16)32-22(23,24)25/h5-6,9-13,15H,2-4,7-8H2,1H3 |
| InChIKey | LAZNMSASCLSSDH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 94.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|