C20H18F2N4O4 — CID 25255976
5-[4-(3,3-difluoropiperidin-1-yl)-3-nitrophenyl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 25255976) has the molecular formula C20H18F2N4O4 and a molecular weight of 416.38 g/mol. Its IUPAC name is 5-[4-(3,3-difluoropiperidin-1-yl)-3-nitrophenyl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[4-(3,3-difluoropiperidin-1-yl)-3-nitrophenyl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25255976 |
| Molecular Formula | C20H18F2N4O4 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 5-[4-(3,3-difluoropiperidin-1-yl)-3-nitrophenyl]-3-(2-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccccc1-c1noc(-c2ccc(N3CCCC(F)(F)C3)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C20H18F2N4O4/c1-29-17-6-3-2-5-14(17)18-23-19(30-24-18)13-7-8-15(16(11-13)26(27)28)25-10-4-9-20(21,22)12-25/h2-3,5-8,11H,4,9-10,12H2,1H3 |
| InChIKey | AURSAESIORZOSI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 94.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|