C34H49NO10 — CID 25256033
[(5R,6S,8R)-11-ethyl-5,7,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-4-phenylmethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-8-yl] acetate (PubChem CID 25256033) has the molecular formula C34H49NO10 and a molecular weight of 631.76 g/mol. Its IUPAC name is [(5R,6S,8R)-11-ethyl-5,7,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-4-phenylmethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-8-yl] acetate.
| Compound Name | [(5R,6S,8R)-11-ethyl-5,7,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-4-phenylmethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-8-yl] acetate |
|---|---|
| PubChem CID | 25256033 |
| Molecular Formula | C34H49NO10 |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | [(5R,6S,8R)-11-ethyl-5,7,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-4-phenylmethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-8-yl] acetate |
| SMILES | CCN1CC2(COC)C(O)CC(OC)C34C5C[C@@]6(O)C(OCc7ccccc7)C5[C@@](OC(C)=O)(C(C(OC)C23)C14)C(O)[C@@H]6OC |
| InChI | InChI=1S/C34H49NO10/c1-7-35-16-31(17-40-3)21(37)13-22(41-4)33-20-14-32(39)29(44-15-19-11-9-8-10-12-19)23(20)34(45-18(2)36,28(38)30(32)43-6)24(27(33)35)25(42-5)26(31)33/h8-12,20-30,37-39H,7,13-17H2,1-6H3/t20?,21?,22?,23?,24?,25?,26?,27?,28?,29?,30-,31?,32+,33?,34+/m0/s1 |
| InChIKey | FVHNNDMHGOBCCJ-AZVFISEISA-N |
| XLogP | 1.01 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |