C11H7N3OS — CID 2525612
N-(3-cyanothiophen-2-yl)pyridine-2-carboxamide (PubChem CID 2525612) has the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)pyridine-2-carboxamide.
| Compound Name | N-(3-cyanothiophen-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 2525612 |
| Molecular Formula | C11H7N3OS |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)pyridine-2-carboxamide |
| SMILES | N#Cc1ccsc1NC(=O)c1ccccn1 |
| InChI | InChI=1S/C11H7N3OS/c12-7-8-4-6-16-11(8)14-10(15)9-3-1-2-5-13-9/h1-6H,(H,14,15) |
| InChIKey | XNEHUAKGYXQSBF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |