About N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine
N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine (PubChem CID 25256206) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine |
| PubChem CID | 25256206 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine |
| SMILES | NCCNc1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C15H24N2O/c16-9-10-17-14-7-4-8-15(11-14)18-12-13-5-2-1-3-6-13/h4,7-8,11,13,17H,1-3,5-6,9-10,12,16H2 |
| InChIKey | YBGJAMUVHFAQAF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine?
The IUPAC name of N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine (CID 25256206) is N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine?
The canonical SMILES for N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine is NCCNc1cccc(OCC2CCCCC2)c1.
What is the InChIKey of N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine?
The InChIKey is YBGJAMUVHFAQAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c16-9-10-17-14-7-4-8-15(11-14)18-12-13-5-2-1-3-6-13/h4,7-8,11,13,17H,1-3,5-6,9-10,12,16H2.
What are the key properties of N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine?
N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine has a molecular weight of 248.37 g/mol, XLogP of 3.02, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(cyclohexylmethoxy)phenyl]ethane-1,2-diamine is sourced from PubChem (CID 25256206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).