C23H19N3O3S — CID 25256698
6-N-hydroxy-2-N-methyl-2-N-[(2-phenyl-1,3-thiazol-5-yl)methyl]naphthalene-2,6-dicarboxamide (PubChem CID 25256698) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 6-N-hydroxy-2-N-methyl-2-N-[(2-phenyl-1,3-thiazol-5-yl)methyl]naphthalene-2,6-dicarboxamide.
| Compound Name | 6-N-hydroxy-2-N-methyl-2-N-[(2-phenyl-1,3-thiazol-5-yl)methyl]naphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25256698 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 6-N-hydroxy-2-N-methyl-2-N-[(2-phenyl-1,3-thiazol-5-yl)methyl]naphthalene-2,6-dicarboxamide |
| SMILES | CN(Cc1cnc(-c2ccccc2)s1)C(=O)c1ccc2cc(C(=O)NO)ccc2c1 |
| InChI | InChI=1S/C23H19N3O3S/c1-26(14-20-13-24-22(30-20)15-5-3-2-4-6-15)23(28)19-10-8-16-11-18(21(27)25-29)9-7-17(16)12-19/h2-13,29H,14H2,1H3,(H,25,27) |
| InChIKey | GBJMSKBBAVGJTC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|