About Artefenomel mesylate
Artefenomel mesylate (PubChem CID 25256739) has the molecular formula C29H43NO8S
and a molecular weight of 565.73 g/mol.
Molecular Properties
| Compound Name | Artefenomel mesylate |
| PubChem CID | 25256739 |
| Molecular Formula | C29H43NO8S |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)O.c1cc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C28H39NO5.CH4O3S/c1-3-26(31-14-11-29-9-12-30-13-10-29)4-2-22(1)23-5-7-27(8-6-23)32-28(34-33-27)24-16-20-15-21(18-24)19-25(28)17-20;1-5(2,3)4/h1-4,20-21,23-25H,5-19H2;1H3,(H,2,3,4) |
| InChIKey | WQAWGRIICHFPFL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze Artefenomel mesylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Artefenomel mesylate?
The IUPAC name of Artefenomel mesylate (CID 25256739) is not available.
What is the SMILES notation for Artefenomel mesylate?
The canonical SMILES for Artefenomel mesylate is CS(=O)(=O)O.c1cc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)ccc1OCCN1CCOCC1.
What is the InChIKey of Artefenomel mesylate?
The InChIKey is WQAWGRIICHFPFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H39NO5.CH4O3S/c1-3-26(31-14-11-29-9-12-30-13-10-29)4-2-22(1)23-5-7-27(8-6-23)32-28(34-33-27)24-16-20-15-21(18-24)19-25(28)17-20;1-5(2,3)4/h1-4,20-21,23-25H,5-19H2;1H3,(H,2,3,4).
What are the key properties of Artefenomel mesylate?
Artefenomel mesylate has a molecular weight of 565.73 g/mol, XLogP of 4.39, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Artefenomel mesylate is sourced from PubChem (CID 25256739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).