C20H28F3N7O2 — CID 25256748
2-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione (PubChem CID 25256748) has the molecular formula C20H28F3N7O2 and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 25256748 |
| Molecular Formula | C20H28F3N7O2 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
| SMILES | CC(C)(C)c1nc(N2CCN(CCCCn3ncc(=O)[nH]c3=O)CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H28F3N7O2/c1-19(2,3)17-25-14(20(21,22)23)12-15(26-17)29-10-8-28(9-11-29)6-4-5-7-30-18(32)27-16(31)13-24-30/h12-13H,4-11H2,1-3H3,(H,27,31,32) |
| InChIKey | NVNXXZKANJPBDY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|