C23H32O4S — CID 25256852
2-[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxyphenyl]sulfanylacetic acid (PubChem CID 25256852) has the molecular formula C23H32O4S and a molecular weight of 404.57 g/mol. Its IUPAC name is 2-[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxyphenyl]sulfanylacetic acid.
| Compound Name | 2-[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxyphenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 25256852 |
| Molecular Formula | C23H32O4S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxyphenyl]sulfanylacetic acid |
| SMILES | CC1=CCC[C@H]2[C@](C)(Cc3cc(O)c(SCC(=O)O)cc3O)[C@@H](C)CC[C@]12C |
| InChI | InChI=1S/C23H32O4S/c1-14-6-5-7-20-22(14,3)9-8-15(2)23(20,4)12-16-10-18(25)19(11-17(16)24)28-13-21(26)27/h6,10-11,15,20,24-25H,5,7-9,12-13H2,1-4H3,(H,26,27)/t15-,20+,22+,23+/m0/s1 |
| InChIKey | XGHBCFVJTXAYHG-APQCTARYSA-N |
| XLogP | 5.62 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|