C20H22N6 — CID 25256950
N-(4-methylphenyl)-4-phenyl-6-piperazin-1-yl-1,3,5-triazin-2-amine (PubChem CID 25256950) has the molecular formula C20H22N6 and a molecular weight of 346.44 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-phenyl-6-piperazin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(4-methylphenyl)-4-phenyl-6-piperazin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 25256950 |
| Molecular Formula | C20H22N6 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-(4-methylphenyl)-4-phenyl-6-piperazin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(Nc2nc(-c3ccccc3)nc(N3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C20H22N6/c1-15-7-9-17(10-8-15)22-19-23-18(16-5-3-2-4-6-16)24-20(25-19)26-13-11-21-12-14-26/h2-10,21H,11-14H2,1H3,(H,22,23,24,25) |
| InChIKey | WVIPDADJOWDLGN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |