About CID 25256989
CID 25256989 (PubChem CID 25256989) has the molecular formula C17H22ClN4O2
and a molecular weight of 349.84 g/mol.
Molecular Properties
| Compound Name | CID 25256989 |
| PubChem CID | 25256989 |
| Molecular Formula | C17H22ClN4O2 |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | — |
| SMILES | CC1(C)C=C(Cn2cnc3c(C(N)=O)cccc32)C(C)(C)N1[O].Cl |
| InChI | InChI=1S/C17H21N4O2.ClH/c1-16(2)8-11(17(3,4)21(16)23)9-20-10-19-14-12(15(18)22)6-5-7-13(14)20;/h5-8,10H,9H2,1-4H3,(H2,18,22);1H |
| InChIKey | VVZPDHCAMCQLDF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 25256989 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25256989?
The IUPAC name of CID 25256989 (CID 25256989) is not available.
What is the SMILES notation for CID 25256989?
The canonical SMILES for CID 25256989 is CC1(C)C=C(Cn2cnc3c(C(N)=O)cccc32)C(C)(C)N1[O].Cl.
What is the InChIKey of CID 25256989?
The InChIKey is VVZPDHCAMCQLDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N4O2.ClH/c1-16(2)8-11(17(3,4)21(16)23)9-20-10-19-14-12(15(18)22)6-5-7-13(14)20;/h5-8,10H,9H2,1-4H3,(H2,18,22);1H.
What are the key properties of CID 25256989?
CID 25256989 has a molecular weight of 349.84 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25256989 is sourced from PubChem (CID 25256989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).