C24H30O4S — CID 25257207
5-benzyl-5-ethyl-4-(6-phenylhexoxy)oxathiole 2,2-dioxide (PubChem CID 25257207) has the molecular formula C24H30O4S and a molecular weight of 414.57 g/mol. Its IUPAC name is 5-benzyl-5-ethyl-4-(6-phenylhexoxy)oxathiole 2,2-dioxide.
| Compound Name | 5-benzyl-5-ethyl-4-(6-phenylhexoxy)oxathiole 2,2-dioxide |
|---|---|
| PubChem CID | 25257207 |
| Molecular Formula | C24H30O4S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 5-benzyl-5-ethyl-4-(6-phenylhexoxy)oxathiole 2,2-dioxide |
| SMILES | CCC1(Cc2ccccc2)OS(=O)(=O)C=C1OCCCCCCc1ccccc1 |
| InChI | InChI=1S/C24H30O4S/c1-2-24(19-22-16-10-6-11-17-22)23(20-29(25,26)28-24)27-18-12-4-3-7-13-21-14-8-5-9-15-21/h5-6,8-11,14-17,20H,2-4,7,12-13,18-19H2,1H3 |
| InChIKey | AIRKZSFXPNZQKQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|