C17H14BrF4NO — CID 25257233
5-bromo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 25257233) has the molecular formula C17H14BrF4NO and a molecular weight of 404.20 g/mol. Its IUPAC name is 5-bromo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-bromo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 25257233 |
| Molecular Formula | C17H14BrF4NO |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 5-bromo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | FC(F)C(F)(F)Oc1cccc(C2CCc3c(Br)cccc3N2)c1 |
| InChI | InChI=1S/C17H14BrF4NO/c18-13-5-2-6-15-12(13)7-8-14(23-15)10-3-1-4-11(9-10)24-17(21,22)16(19)20/h1-6,9,14,16,23H,7-8H2 |
| InChIKey | YPHYXKSYJDAHGF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|