C25H26N4O3 — CID 25257366
3-(6-methoxynaphthalen-2-yl)-N-(2-morpholin-4-ylethyl)-1H-indazole-5-carboxamide (PubChem CID 25257366) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-(6-methoxynaphthalen-2-yl)-N-(2-morpholin-4-ylethyl)-1H-indazole-5-carboxamide.
| Compound Name | 3-(6-methoxynaphthalen-2-yl)-N-(2-morpholin-4-ylethyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 25257366 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-(6-methoxynaphthalen-2-yl)-N-(2-morpholin-4-ylethyl)-1H-indazole-5-carboxamide |
| SMILES | COc1ccc2cc(-c3n[nH]c4ccc(C(=O)NCCN5CCOCC5)cc34)ccc2c1 |
| InChI | InChI=1S/C25H26N4O3/c1-31-21-6-4-17-14-19(3-2-18(17)15-21)24-22-16-20(5-7-23(22)27-28-24)25(30)26-8-9-29-10-12-32-13-11-29/h2-7,14-16H,8-13H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | ZDCAJIHSWURBJK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |