About 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide
5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide (PubChem CID 25257676) has the molecular formula C24H22O4S
and a molecular weight of 406.50 g/mol. Its IUPAC name is 5,5-dibenzyl-4-phenylmethoxyoxathiole 2,2-dioxide.
Molecular Properties
| Compound Name | 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide |
| PubChem CID | 25257676 |
| Molecular Formula | C24H22O4S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 5,5-dibenzyl-4-phenylmethoxyoxathiole 2,2-dioxide |
| SMILES | C1=CC=C(C=C1)CC2(C(=CS(=O)(=O)O2)OCC3=CC=CC=C3)CC4=CC=CC=C4 |
| InChI | InChI=1S/C24H22O4S/c25-29(26)19-23(27-18-22-14-8-3-9-15-22)24(28-29,16-20-10-4-1-5-11-20)17-21-12-6-2-7-13-21/h1-15,19H,16-18H2 |
| InChIKey | BFXXIQBFCMYQEE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | 625 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide?
The IUPAC name of 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide (CID 25257676) is 5,5-dibenzyl-4-phenylmethoxyoxathiole 2,2-dioxide.
What is the SMILES notation for 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide?
The canonical SMILES for 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide is C1=CC=C(C=C1)CC2(C(=CS(=O)(=O)O2)OCC3=CC=CC=C3)CC4=CC=CC=C4.
What is the InChIKey of 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide?
The InChIKey is BFXXIQBFCMYQEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O4S/c25-29(26)19-23(27-18-22-14-8-3-9-15-22)24(28-29,16-20-10-4-1-5-11-20)17-21-12-6-2-7-13-21/h1-15,19H,16-18H2.
What are the key properties of 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide?
5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide has a molecular weight of 406.50 g/mol, XLogP of 4.60, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-Dibenzyl-4-benzyloxy-oxathiole 2,2-dioxide is sourced from PubChem (CID 25257676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).